C17H18N8O2S2 — CID 122291281
N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 122291281) has the molecular formula C17H18N8O2S2 and a molecular weight of 430.52 g/mol. Its IUPAC name is N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 122291281 |
| Molecular Formula | C17H18N8O2S2 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | N-[2-[[2-methyl-6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | Cc1nc(NCCNS(=O)(=O)c2cccc3nsnc23)cc(-n2ccnc2C)n1 |
| InChI | InChI=1S/C17H18N8O2S2/c1-11-21-15(10-16(22-11)25-9-8-18-12(25)2)19-6-7-20-29(26,27)14-5-3-4-13-17(14)24-28-23-13/h3-5,8-10,20H,6-7H2,1-2H3,(H,19,21,22) |
| InChIKey | AAZJCTNMDMNQRE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 127.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|