C16H19N7O3S2 — CID 122328125
N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 122328125) has the molecular formula C16H19N7O3S2 and a molecular weight of 421.51 g/mol. Its IUPAC name is N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 122328125 |
| Molecular Formula | C16H19N7O3S2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | O=S(=O)(NCCNc1cc(N2CCOCC2)ncn1)c1cccc2nsnc12 |
| InChI | InChI=1S/C16H19N7O3S2/c24-28(25,13-3-1-2-12-16(13)22-27-21-12)20-5-4-17-14-10-15(19-11-18-14)23-6-8-26-9-7-23/h1-3,10-11,20H,4-9H2,(H,17,18,19) |
| InChIKey | ZJJRSUISFYGWPW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 122.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|