C17H22FN5O3S — CID 50945553
2-fluoro-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide (PubChem CID 50945553) has the molecular formula C17H22FN5O3S and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-fluoro-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 2-fluoro-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 50945553 |
| Molecular Formula | C17H22FN5O3S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 2-fluoro-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
| SMILES | Cc1nc(NCCNS(=O)(=O)c2ccccc2F)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C17H22FN5O3S/c1-13-21-16(12-17(22-13)23-8-10-26-11-9-23)19-6-7-20-27(24,25)15-5-3-2-4-14(15)18/h2-5,12,20H,6-11H2,1H3,(H,19,21,22) |
| InChIKey | VWQLISOQGCQULG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|