C17H27N7O3S — CID 122294298
1-ethyl-2-methyl-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]imidazole-4-sulfonamide (PubChem CID 122294298) has the molecular formula C17H27N7O3S and a molecular weight of 409.52 g/mol. Its IUPAC name is 1-ethyl-2-methyl-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]imidazole-4-sulfonamide.
| Compound Name | 1-ethyl-2-methyl-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 122294298 |
| Molecular Formula | C17H27N7O3S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 1-ethyl-2-methyl-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]imidazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCCNc2cc(N3CCOCC3)nc(C)n2)nc1C |
| InChI | InChI=1S/C17H27N7O3S/c1-4-23-12-17(22-14(23)3)28(25,26)19-6-5-18-15-11-16(21-13(2)20-15)24-7-9-27-10-8-24/h11-12,19H,4-10H2,1-3H3,(H,18,20,21) |
| InChIKey | UADYCMZOWZLPCL-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|