C16H25N7O3S — CID 122321748
1-ethyl-2-methyl-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]imidazole-4-sulfonamide (PubChem CID 122321748) has the molecular formula C16H25N7O3S and a molecular weight of 395.49 g/mol. Its IUPAC name is 1-ethyl-2-methyl-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]imidazole-4-sulfonamide.
| Compound Name | 1-ethyl-2-methyl-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 122321748 |
| Molecular Formula | C16H25N7O3S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 1-ethyl-2-methyl-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]imidazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCCNc2cc(N3CCOCC3)cnn2)nc1C |
| InChI | InChI=1S/C16H25N7O3S/c1-3-22-12-16(20-13(22)2)27(24,25)19-5-4-17-15-10-14(11-18-21-15)23-6-8-26-9-7-23/h10-12,19H,3-9H2,1-2H3,(H,17,21) |
| InChIKey | CKPGRJOALDTBMA-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|