C18H24N6O2 — CID 122321473
1-(2-methylphenyl)-3-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]urea (PubChem CID 122321473) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]urea.
| Compound Name | 1-(2-methylphenyl)-3-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 122321473 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 1-(2-methylphenyl)-3-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]urea |
| SMILES | Cc1ccccc1NC(=O)NCCNc1cc(N2CCOCC2)cnn1 |
| InChI | InChI=1S/C18H24N6O2/c1-14-4-2-3-5-16(14)22-18(25)20-7-6-19-17-12-15(13-21-23-17)24-8-10-26-11-9-24/h2-5,12-13H,6-11H2,1H3,(H,19,23)(H2,20,22,25) |
| InChIKey | NIGCBLZTIDZMAO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|