C18H21F3N6O2S — CID 122321521
1-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-3-[4-(trifluoromethylsulfanyl)phenyl]urea (PubChem CID 122321521) has the molecular formula C18H21F3N6O2S and a molecular weight of 442.47 g/mol. Its IUPAC name is 1-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-3-[4-(trifluoromethylsulfanyl)phenyl]urea.
| Compound Name | 1-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-3-[4-(trifluoromethylsulfanyl)phenyl]urea |
|---|---|
| PubChem CID | 122321521 |
| Molecular Formula | C18H21F3N6O2S |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-3-[4-(trifluoromethylsulfanyl)phenyl]urea |
| SMILES | O=C(NCCNc1cc(N2CCOCC2)cnn1)Nc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H21F3N6O2S/c19-18(20,21)30-15-3-1-13(2-4-15)25-17(28)23-6-5-22-16-11-14(12-24-26-16)27-7-9-29-10-8-27/h1-4,11-12H,5-10H2,(H,22,26)(H2,23,25,28) |
| InChIKey | ZPMNZWLUNUUUPR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|