C16H19FN6O2 — CID 122321690
5-fluoro-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]pyridine-3-carboxamide (PubChem CID 122321690) has the molecular formula C16H19FN6O2 and a molecular weight of 346.37 g/mol. Its IUPAC name is 5-fluoro-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]pyridine-3-carboxamide.
| Compound Name | 5-fluoro-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 122321690 |
| Molecular Formula | C16H19FN6O2 |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 5-fluoro-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCNc1cc(N2CCOCC2)cnn1)c1cncc(F)c1 |
| InChI | InChI=1S/C16H19FN6O2/c17-13-7-12(9-18-10-13)16(24)20-2-1-19-15-8-14(11-21-22-15)23-3-5-25-6-4-23/h7-11H,1-6H2,(H,19,22)(H,20,24) |
| InChIKey | JJGUUQUWTCJJOM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|