C16H19N5O4 — CID 122321526
N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-6-oxopyran-3-carboxamide (PubChem CID 122321526) has the molecular formula C16H19N5O4 and a molecular weight of 345.36 g/mol. Its IUPAC name is N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-6-oxopyran-3-carboxamide.
| Compound Name | N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-6-oxopyran-3-carboxamide |
|---|---|
| PubChem CID | 122321526 |
| Molecular Formula | C16H19N5O4 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-6-oxopyran-3-carboxamide |
| SMILES | O=C(NCCNc1cc(N2CCOCC2)cnn1)c1ccc(=O)oc1 |
| InChI | InChI=1S/C16H19N5O4/c22-15-2-1-12(11-25-15)16(23)18-4-3-17-14-9-13(10-19-20-14)21-5-7-24-8-6-21/h1-2,9-11H,3-8H2,(H,17,20)(H,18,23) |
| InChIKey | CKKWYASJICRDNX-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 109.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|