C18H21N5O3 — CID 122321037
N-[2-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 122321037) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is N-[2-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 122321037 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-[2-[(5-pyrrolidin-1-ylpyridazin-3-yl)amino]ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCCNc1cc(N2CCCC2)cnn1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H21N5O3/c24-18(13-3-4-15-16(9-13)26-12-25-15)20-6-5-19-17-10-14(11-21-22-17)23-7-1-2-8-23/h3-4,9-11H,1-2,5-8,12H2,(H,19,22)(H,20,24) |
| InChIKey | URNWHGHVSLQRLY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|