C18H21N5O4 — CID 70702890
N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 70702890) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 70702890 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCCNc1cc(N2CCOCC2)ncn1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H21N5O4/c24-18(13-1-2-14-15(9-13)27-12-26-14)20-4-3-19-16-10-17(22-11-21-16)23-5-7-25-8-6-23/h1-2,9-11H,3-8,12H2,(H,20,24)(H,19,21,22) |
| InChIKey | QUDOPDDPDZUKNH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|