C17H20N6O4 — CID 122328147
N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-2-nitrobenzamide (PubChem CID 122328147) has the molecular formula C17H20N6O4 and a molecular weight of 372.39 g/mol. Its IUPAC name is N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-2-nitrobenzamide.
| Compound Name | N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 122328147 |
| Molecular Formula | C17H20N6O4 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-2-nitrobenzamide |
| SMILES | O=C(NCCNc1cc(N2CCOCC2)ncn1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H20N6O4/c24-17(13-3-1-2-4-14(13)23(25)26)19-6-5-18-15-11-16(21-12-20-15)22-7-9-27-10-8-22/h1-4,11-12H,5-10H2,(H,19,24)(H,18,20,21) |
| InChIKey | UYRVYDRMVDDGBV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|