C18H20N6O4 — CID 122327907
5-(furan-2-yl)-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-3-carboxamide (PubChem CID 122327907) has the molecular formula C18H20N6O4 and a molecular weight of 384.40 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 122327907 |
| Molecular Formula | C18H20N6O4 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 5-(furan-2-yl)-N-[2-[(6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCNc1cc(N2CCOCC2)ncn1)c1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C18H20N6O4/c25-18(13-10-15(28-23-13)14-2-1-7-27-14)20-4-3-19-16-11-17(22-12-21-16)24-5-8-26-9-6-24/h1-2,7,10-12H,3-6,8-9H2,(H,20,25)(H,19,21,22) |
| InChIKey | ZGQZYZFQMKLTCG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 118.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|