C20H22N6O2 — CID 122327578
5-phenyl-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-3-carboxamide (PubChem CID 122327578) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 5-phenyl-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-phenyl-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 122327578 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 5-phenyl-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCNc1cc(N2CCCC2)ncn1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C20H22N6O2/c27-20(16-12-17(28-25-16)15-6-2-1-3-7-15)22-9-8-21-18-13-19(24-14-23-18)26-10-4-5-11-26/h1-3,6-7,12-14H,4-5,8-11H2,(H,22,27)(H,21,23,24) |
| InChIKey | BZFASQGCXGTBPP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|