C14H18N6O2 — CID 122327533
N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-5-carboxamide (PubChem CID 122327533) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 122327533 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCCNc1cc(N2CCCC2)ncn1)c1ccno1 |
| InChI | InChI=1S/C14H18N6O2/c21-14(11-3-4-19-22-11)16-6-5-15-12-9-13(18-10-17-12)20-7-1-2-8-20/h3-4,9-10H,1-2,5-8H2,(H,16,21)(H,15,17,18) |
| InChIKey | OKFDGKWYFBCKAS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|