C13H18F3N5O — CID 122327666
3,3,3-trifluoro-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]propanamide (PubChem CID 122327666) has the molecular formula C13H18F3N5O and a molecular weight of 317.32 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]propanamide.
| Compound Name | 3,3,3-trifluoro-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 122327666 |
| Molecular Formula | C13H18F3N5O |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 3,3,3-trifluoro-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]propanamide |
| SMILES | O=C(CC(F)(F)F)NCCNc1cc(N2CCCC2)ncn1 |
| InChI | InChI=1S/C13H18F3N5O/c14-13(15,16)8-12(22)18-4-3-17-10-7-11(20-9-19-10)21-5-1-2-6-21/h7,9H,1-6,8H2,(H,18,22)(H,17,19,20) |
| InChIKey | GBYCGPGJMORFJK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|