C14H24N6O2S — CID 122327764
N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]pyrrolidine-1-sulfonamide (PubChem CID 122327764) has the molecular formula C14H24N6O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]pyrrolidine-1-sulfonamide.
| Compound Name | N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 122327764 |
| Molecular Formula | C14H24N6O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]pyrrolidine-1-sulfonamide |
| SMILES | O=S(=O)(NCCNc1cc(N2CCCC2)ncn1)N1CCCC1 |
| InChI | InChI=1S/C14H24N6O2S/c21-23(22,20-9-3-4-10-20)18-6-5-15-13-11-14(17-12-16-13)19-7-1-2-8-19/h11-12,18H,1-10H2,(H,15,16,17) |
| InChIKey | HVYQAQACEBRSJK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|