C17H21N7O6S — CID 122327789
4-methyl-3,5-dinitro-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide (PubChem CID 122327789) has the molecular formula C17H21N7O6S and a molecular weight of 451.47 g/mol. Its IUPAC name is 4-methyl-3,5-dinitro-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-methyl-3,5-dinitro-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122327789 |
| Molecular Formula | C17H21N7O6S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 4-methyl-3,5-dinitro-N-[2-[(6-pyrrolidin-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
| SMILES | Cc1c([N+](=O)[O-])cc(S(=O)(=O)NCCNc2cc(N3CCCC3)ncn2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H21N7O6S/c1-12-14(23(25)26)8-13(9-15(12)24(27)28)31(29,30)21-5-4-18-16-10-17(20-11-19-16)22-6-2-3-7-22/h8-11,21H,2-7H2,1H3,(H,18,19,20) |
| InChIKey | NSRWSLFKCAIISE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 173.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|