C16H21N7O6S — CID 122325620
N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-4-methyl-3,5-dinitrobenzenesulfonamide (PubChem CID 122325620) has the molecular formula C16H21N7O6S and a molecular weight of 439.45 g/mol. Its IUPAC name is N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-4-methyl-3,5-dinitrobenzenesulfonamide.
| Compound Name | N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-4-methyl-3,5-dinitrobenzenesulfonamide |
|---|---|
| PubChem CID | 122325620 |
| Molecular Formula | C16H21N7O6S |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-4-methyl-3,5-dinitrobenzenesulfonamide |
| SMILES | CCNc1nc(C)cc(NCCNS(=O)(=O)c2cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C16H21N7O6S/c1-4-17-16-20-10(2)7-15(21-16)18-5-6-19-30(28,29)12-8-13(22(24)25)11(3)14(9-12)23(26)27/h7-9,19H,4-6H2,1-3H3,(H2,17,18,20,21) |
| InChIKey | FWFHTTJGJFKTQT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 182.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|