C14H23N7O2S — CID 122325574
N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-1,2-dimethylimidazole-4-sulfonamide (PubChem CID 122325574) has the molecular formula C14H23N7O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-1,2-dimethylimidazole-4-sulfonamide.
| Compound Name | N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-1,2-dimethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 122325574 |
| Molecular Formula | C14H23N7O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-1,2-dimethylimidazole-4-sulfonamide |
| SMILES | CCNc1nc(C)cc(NCCNS(=O)(=O)c2cn(C)c(C)n2)n1 |
| InChI | InChI=1S/C14H23N7O2S/c1-5-15-14-18-10(2)8-12(20-14)16-6-7-17-24(22,23)13-9-21(4)11(3)19-13/h8-9,17H,5-7H2,1-4H3,(H2,15,16,18,20) |
| InChIKey | AJEVYPFJXKGFPC-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|