C13H24N6O2S — CID 122325596
N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]pyrrolidine-1-sulfonamide (PubChem CID 122325596) has the molecular formula C13H24N6O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]pyrrolidine-1-sulfonamide.
| Compound Name | N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 122325596 |
| Molecular Formula | C13H24N6O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]pyrrolidine-1-sulfonamide |
| SMILES | CCNc1nc(C)cc(NCCNS(=O)(=O)N2CCCC2)n1 |
| InChI | InChI=1S/C13H24N6O2S/c1-3-14-13-17-11(2)10-12(18-13)15-6-7-16-22(20,21)19-8-4-5-9-19/h10,16H,3-9H2,1-2H3,(H2,14,15,17,18) |
| InChIKey | PFKWMGGSFGZUMM-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|