C16H22ClN5O2S — CID 122325548
1-(4-chlorophenyl)-N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]methanesulfonamide (PubChem CID 122325548) has the molecular formula C16H22ClN5O2S and a molecular weight of 383.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]methanesulfonamide.
| Compound Name | 1-(4-chlorophenyl)-N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 122325548 |
| Molecular Formula | C16H22ClN5O2S |
| Molecular Weight | 383.91 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]methanesulfonamide |
| SMILES | CCNc1nc(C)cc(NCCNS(=O)(=O)Cc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H22ClN5O2S/c1-3-18-16-21-12(2)10-15(22-16)19-8-9-20-25(23,24)11-13-4-6-14(17)7-5-13/h4-7,10,20H,3,8-9,11H2,1-2H3,(H2,18,19,21,22) |
| InChIKey | BSCLLXARNRNFSP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.91 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|