C12H20F3N5O2S — CID 122324769
N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-3,3,3-trifluoropropane-1-sulfonamide (PubChem CID 122324769) has the molecular formula C12H20F3N5O2S and a molecular weight of 355.39 g/mol. Its IUPAC name is N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-3,3,3-trifluoropropane-1-sulfonamide.
| Compound Name | N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-3,3,3-trifluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 122324769 |
| Molecular Formula | C12H20F3N5O2S |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-3,3,3-trifluoropropane-1-sulfonamide |
| SMILES | CCNc1cc(C)nc(NCCNS(=O)(=O)CCC(F)(F)F)n1 |
| InChI | InChI=1S/C12H20F3N5O2S/c1-3-16-10-8-9(2)19-11(20-10)17-5-6-18-23(21,22)7-4-12(13,14)15/h8,18H,3-7H2,1-2H3,(H2,16,17,19,20) |
| InChIKey | JYODEMUFJDHLNQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|