C17H25N5O3S — CID 122324527
N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-methoxy-3-methylbenzenesulfonamide (PubChem CID 122324527) has the molecular formula C17H25N5O3S and a molecular weight of 379.49 g/mol. Its IUPAC name is N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-methoxy-3-methylbenzenesulfonamide.
| Compound Name | N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-methoxy-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 122324527 |
| Molecular Formula | C17H25N5O3S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-[2-[[4-(ethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-methoxy-3-methylbenzenesulfonamide |
| SMILES | CCNc1cc(C)nc(NCCNS(=O)(=O)c2ccc(OC)c(C)c2)n1 |
| InChI | InChI=1S/C17H25N5O3S/c1-5-18-16-11-13(3)21-17(22-16)19-8-9-20-26(23,24)14-6-7-15(25-4)12(2)10-14/h6-7,10-11,20H,5,8-9H2,1-4H3,(H2,18,19,21,22) |
| InChIKey | DXFFNQOHFIXLIL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|