C17H25N5O2S — CID 121074792
N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-3,4-dimethylbenzenesulfonamide (PubChem CID 121074792) has the molecular formula C17H25N5O2S and a molecular weight of 363.49 g/mol. Its IUPAC name is N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 121074792 |
| Molecular Formula | C17H25N5O2S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-3,4-dimethylbenzenesulfonamide |
| SMILES | CCNc1cc(NCCNS(=O)(=O)c2ccc(C)c(C)c2)nc(C)n1 |
| InChI | InChI=1S/C17H25N5O2S/c1-5-18-16-11-17(22-14(4)21-16)19-8-9-20-25(23,24)15-7-6-12(2)13(3)10-15/h6-7,10-11,20H,5,8-9H2,1-4H3,(H2,18,19,21,22) |
| InChIKey | AQQHPBSFRSPRIX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|