C16H24N6O3S2 — CID 122293527
N-[[5-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide (PubChem CID 122293527) has the molecular formula C16H24N6O3S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is N-[[5-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide.
| Compound Name | N-[[5-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 122293527 |
| Molecular Formula | C16H24N6O3S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-[[5-[2-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide |
| SMILES | CCNc1cc(NCCNS(=O)(=O)c2ccc(CNC(C)=O)s2)nc(C)n1 |
| InChI | InChI=1S/C16H24N6O3S2/c1-4-17-14-9-15(22-11(2)21-14)18-7-8-20-27(24,25)16-6-5-13(26-16)10-19-12(3)23/h5-6,9,20H,4,7-8,10H2,1-3H3,(H,19,23)(H2,17,18,21,22) |
| InChIKey | DBDWMGVDGKEVDZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 125.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|