C18H22N6O3S2 — CID 122308770
N-[[5-[2-[(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)amino]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide (PubChem CID 122308770) has the molecular formula C18H22N6O3S2 and a molecular weight of 434.55 g/mol. Its IUPAC name is N-[[5-[2-[(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)amino]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide.
| Compound Name | N-[[5-[2-[(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)amino]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 122308770 |
| Molecular Formula | C18H22N6O3S2 |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | N-[[5-[2-[(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)amino]ethylsulfamoyl]thiophen-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(S(=O)(=O)NCCNc2cc(-n3cccc3)nc(C)n2)s1 |
| InChI | InChI=1S/C18H22N6O3S2/c1-13-22-16(11-17(23-13)24-9-3-4-10-24)19-7-8-21-29(26,27)18-6-5-15(28-18)12-20-14(2)25/h3-6,9-11,21H,7-8,12H2,1-2H3,(H,20,25)(H,19,22,23) |
| InChIKey | ONSCTLYQSGSCNF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|