C18H20FN5O2S — CID 122308729
1-(3-fluorophenyl)-N-[2-[(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]methanesulfonamide (PubChem CID 122308729) has the molecular formula C18H20FN5O2S and a molecular weight of 389.46 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[2-[(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]methanesulfonamide.
| Compound Name | 1-(3-fluorophenyl)-N-[2-[(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 122308729 |
| Molecular Formula | C18H20FN5O2S |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[2-[(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]methanesulfonamide |
| SMILES | Cc1nc(NCCNS(=O)(=O)Cc2cccc(F)c2)cc(-n2cccc2)n1 |
| InChI | InChI=1S/C18H20FN5O2S/c1-14-22-17(12-18(23-14)24-9-2-3-10-24)20-7-8-21-27(25,26)13-15-5-4-6-16(19)11-15/h2-6,9-12,21H,7-8,13H2,1H3,(H,20,22,23) |
| InChIKey | RKBIIZPNADGMNV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|