C17H19FN6O2S — CID 122290038
4-fluoro-2-methyl-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide (PubChem CID 122290038) has the molecular formula C17H19FN6O2S and a molecular weight of 390.44 g/mol. Its IUPAC name is 4-fluoro-2-methyl-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-2-methyl-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122290038 |
| Molecular Formula | C17H19FN6O2S |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 4-fluoro-2-methyl-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
| SMILES | Cc1nc(NCCNS(=O)(=O)c2ccc(F)cc2C)cc(-n2cccn2)n1 |
| InChI | InChI=1S/C17H19FN6O2S/c1-12-10-14(18)4-5-15(12)27(25,26)21-8-7-19-16-11-17(23-13(2)22-16)24-9-3-6-20-24/h3-6,9-11,21H,7-8H2,1-2H3,(H,19,22,23) |
| InChIKey | PYIZQTYAZUDMJX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|