C18H22N6O4S — CID 121072562
2,4-dimethoxy-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide (PubChem CID 121072562) has the molecular formula C18H22N6O4S and a molecular weight of 418.48 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 2,4-dimethoxy-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121072562 |
| Molecular Formula | C18H22N6O4S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2,4-dimethoxy-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNc2cc(-n3cccn3)nc(C)n2)c(OC)c1 |
| InChI | InChI=1S/C18H22N6O4S/c1-13-22-17(12-18(23-13)24-10-4-7-20-24)19-8-9-21-29(25,26)16-6-5-14(27-2)11-15(16)28-3/h4-7,10-12,21H,8-9H2,1-3H3,(H,19,22,23) |
| InChIKey | AQKKZBAELOMMCX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|