C21H20N6O3S — CID 121072880
4-methoxy-N-[4-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]benzenesulfonamide (PubChem CID 121072880) has the molecular formula C21H20N6O3S and a molecular weight of 436.50 g/mol. Its IUPAC name is 4-methoxy-N-[4-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[4-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121072880 |
| Molecular Formula | C21H20N6O3S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 4-methoxy-N-[4-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(Nc3cc(-n4cccn4)nc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C21H20N6O3S/c1-15-23-20(14-21(24-15)27-13-3-12-22-27)25-16-4-6-17(7-5-16)26-31(28,29)19-10-8-18(30-2)9-11-19/h3-14,26H,1-2H3,(H,23,24,25) |
| InChIKey | WLPSKMIDJPAZOV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |