C23H23N7O2 — CID 121072973
1-(4-ethoxyphenyl)-3-[4-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]urea (PubChem CID 121072973) has the molecular formula C23H23N7O2 and a molecular weight of 429.48 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-[4-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]urea.
| Compound Name | 1-(4-ethoxyphenyl)-3-[4-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]urea |
|---|---|
| PubChem CID | 121072973 |
| Molecular Formula | C23H23N7O2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-[4-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]urea |
| SMILES | CCOc1ccc(NC(=O)Nc2ccc(Nc3cc(-n4cccn4)nc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C23H23N7O2/c1-3-32-20-11-9-19(10-12-20)29-23(31)28-18-7-5-17(6-8-18)27-21-15-22(26-16(2)25-21)30-14-4-13-24-30/h4-15H,3H2,1-2H3,(H,25,26,27)(H2,28,29,31) |
| InChIKey | SHHDFNJZACPURM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |