C23H22N6O3 — CID 122310042
1-(4-ethoxyphenyl)-3-[4-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)oxyphenyl]urea (PubChem CID 122310042) has the molecular formula C23H22N6O3 and a molecular weight of 430.47 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-[4-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)oxyphenyl]urea.
| Compound Name | 1-(4-ethoxyphenyl)-3-[4-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)oxyphenyl]urea |
|---|---|
| PubChem CID | 122310042 |
| Molecular Formula | C23H22N6O3 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-[4-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)oxyphenyl]urea |
| SMILES | CCOc1ccc(NC(=O)Nc2ccc(Oc3cc(-n4cccn4)nc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C23H22N6O3/c1-3-31-19-9-5-17(6-10-19)27-23(30)28-18-7-11-20(12-8-18)32-22-15-21(25-16(2)26-22)29-14-4-13-24-29/h4-15H,3H2,1-2H3,(H2,27,28,30) |
| InChIKey | PSSYFTDKQRYUHM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |