C21H19N7O — CID 121072953
1-[4-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]-3-phenylurea (PubChem CID 121072953) has the molecular formula C21H19N7O and a molecular weight of 385.43 g/mol. Its IUPAC name is 1-[4-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 121072953 |
| Molecular Formula | C21H19N7O |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 1-[4-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]-3-phenylurea |
| SMILES | Cc1nc(Nc2ccc(NC(=O)Nc3ccccc3)cc2)cc(-n2cccn2)n1 |
| InChI | InChI=1S/C21H19N7O/c1-15-23-19(14-20(24-15)28-13-5-12-22-28)25-17-8-10-18(11-9-17)27-21(29)26-16-6-3-2-4-7-16/h2-14H,1H3,(H,23,24,25)(H2,26,27,29) |
| InChIKey | XJGYFYUBXUHGOF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |