C13H15N7O3S — CID 122290039
N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-4-sulfonamide (PubChem CID 122290039) has the molecular formula C13H15N7O3S and a molecular weight of 349.38 g/mol. Its IUPAC name is N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 122290039 |
| Molecular Formula | C13H15N7O3S |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1nc(NCCNS(=O)(=O)c2cnoc2)cc(-n2cccn2)n1 |
| InChI | InChI=1S/C13H15N7O3S/c1-10-18-12(7-13(19-10)20-6-2-3-15-20)14-4-5-17-24(21,22)11-8-16-23-9-11/h2-3,6-9,17H,4-5H2,1H3,(H,14,18,19) |
| InChIKey | DIUUHCIONLWDOZ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 127.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|