C14H15N7O2 — CID 122289833
N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-5-carboxamide (PubChem CID 122289833) has the molecular formula C14H15N7O2 and a molecular weight of 313.32 g/mol. Its IUPAC name is N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 122289833 |
| Molecular Formula | C14H15N7O2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-1,2-oxazole-5-carboxamide |
| SMILES | Cc1nc(NCCNC(=O)c2ccno2)cc(-n2cccn2)n1 |
| InChI | InChI=1S/C14H15N7O2/c1-10-19-12(9-13(20-10)21-8-2-4-17-21)15-6-7-16-14(22)11-3-5-18-23-11/h2-5,8-9H,6-7H2,1H3,(H,16,22)(H,15,19,20) |
| InChIKey | URZAZXCIYWBPSP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 110.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|