C20H22N6O — CID 122289974
(E)-3-(2-methylphenyl)-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]prop-2-enamide (PubChem CID 122289974) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is (E)-3-(2-methylphenyl)-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2-methylphenyl)-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 122289974 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (E)-3-(2-methylphenyl)-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]prop-2-enamide |
| SMILES | Cc1nc(NCCNC(=O)/C=C/c2ccccc2C)cc(-n2cccn2)n1 |
| InChI | InChI=1S/C20H22N6O/c1-15-6-3-4-7-17(15)8-9-20(27)22-12-11-21-18-14-19(25-16(2)24-18)26-13-5-10-23-26/h3-10,13-14H,11-12H2,1-2H3,(H,22,27)(H,21,24,25)/b9-8+ |
| InChIKey | BLRZMMHXCKFEPT-CMDGGOBGSA-N |
| XLogP | 2.52 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|