C18H18F3N7O — CID 122290062
1-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 122290062) has the molecular formula C18H18F3N7O and a molecular weight of 405.38 g/mol. Its IUPAC name is 1-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 122290062 |
| Molecular Formula | C18H18F3N7O |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1nc(NCCNC(=O)Nc2ccccc2C(F)(F)F)cc(-n2cccn2)n1 |
| InChI | InChI=1S/C18H18F3N7O/c1-12-25-15(11-16(26-12)28-10-4-7-24-28)22-8-9-23-17(29)27-14-6-3-2-5-13(14)18(19,20)21/h2-7,10-11H,8-9H2,1H3,(H,22,25,26)(H2,23,27,29) |
| InChIKey | HRXAZZKVGCAVLQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|