C15H22N6O — CID 121072306
3-methyl-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]butanamide (PubChem CID 121072306) has the molecular formula C15H22N6O and a molecular weight of 302.38 g/mol. Its IUPAC name is 3-methyl-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]butanamide.
| Compound Name | 3-methyl-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]butanamide |
|---|---|
| PubChem CID | 121072306 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 3-methyl-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]butanamide |
| SMILES | Cc1nc(NCCNC(=O)CC(C)C)cc(-n2cccn2)n1 |
| InChI | InChI=1S/C15H22N6O/c1-11(2)9-15(22)17-7-6-16-13-10-14(20-12(3)19-13)21-8-4-5-18-21/h4-5,8,10-11H,6-7,9H2,1-3H3,(H,17,22)(H,16,19,20) |
| InChIKey | ZEUBLXQQZJOPAO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|