C15H14Cl2N6OS — CID 122289978
2,5-dichloro-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]thiophene-3-carboxamide (PubChem CID 122289978) has the molecular formula C15H14Cl2N6OS and a molecular weight of 397.29 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 122289978 |
| Molecular Formula | C15H14Cl2N6OS |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 2,5-dichloro-N-[2-[(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]thiophene-3-carboxamide |
| SMILES | Cc1nc(NCCNC(=O)c2cc(Cl)sc2Cl)cc(-n2cccn2)n1 |
| InChI | InChI=1S/C15H14Cl2N6OS/c1-9-21-12(8-13(22-9)23-6-2-3-20-23)18-4-5-19-15(24)10-7-11(16)25-14(10)17/h2-3,6-8H,4-5H2,1H3,(H,19,24)(H,18,21,22) |
| InChIKey | UPFYJFJNPJVQMH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|