C17H18FN7O — CID 56699143
1-(3-fluoro-2-methylphenyl)-3-[2-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]urea (PubChem CID 56699143) has the molecular formula C17H18FN7O and a molecular weight of 355.38 g/mol. Its IUPAC name is 1-(3-fluoro-2-methylphenyl)-3-[2-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]urea.
| Compound Name | 1-(3-fluoro-2-methylphenyl)-3-[2-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 56699143 |
| Molecular Formula | C17H18FN7O |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 1-(3-fluoro-2-methylphenyl)-3-[2-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]urea |
| SMILES | Cc1c(F)cccc1NC(=O)NCCNc1cc(-n2cccn2)ncn1 |
| InChI | InChI=1S/C17H18FN7O/c1-12-13(18)4-2-5-14(12)24-17(26)20-8-7-19-15-10-16(22-11-21-15)25-9-3-6-23-25/h2-6,9-11H,7-8H2,1H3,(H,19,21,22)(H2,20,24,26) |
| InChIKey | LCOAVUWZZOAPHA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|