C17H16F3N7O — CID 30868250
1-[2-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 30868250) has the molecular formula C17H16F3N7O and a molecular weight of 391.36 g/mol. Its IUPAC name is 1-[2-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 30868250 |
| Molecular Formula | C17H16F3N7O |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 1-[2-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]ethyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCCNc1cc(-n2cccn2)ncn1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F3N7O/c18-17(19,20)12-3-1-4-13(9-12)26-16(28)22-7-6-21-14-10-15(24-11-23-14)27-8-2-5-25-27/h1-5,8-11H,6-7H2,(H,21,23,24)(H2,22,26,28) |
| InChIKey | KRTVPMKYCPEGRE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|