C18H19F2N7O2 — CID 122328270
1-[3-(difluoromethoxy)phenyl]-3-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]urea (PubChem CID 122328270) has the molecular formula C18H19F2N7O2 and a molecular weight of 403.39 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-3-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]urea.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-3-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 122328270 |
| Molecular Formula | C18H19F2N7O2 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-3-[2-[[6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]amino]ethyl]urea |
| SMILES | Cc1ccn(-c2cc(NCCNC(=O)Nc3cccc(OC(F)F)c3)ncn2)n1 |
| InChI | InChI=1S/C18H19F2N7O2/c1-12-5-8-27(26-12)16-10-15(23-11-24-16)21-6-7-22-18(28)25-13-3-2-4-14(9-13)29-17(19)20/h2-5,8-11,17H,6-7H2,1H3,(H,21,23,24)(H2,22,25,28) |
| InChIKey | RVOYKOMSFDXZHC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|