C19H23N7O3 — CID 121074223
1-(3,5-dimethoxyphenyl)-3-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]urea (PubChem CID 121074223) has the molecular formula C19H23N7O3 and a molecular weight of 397.44 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]urea.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 121074223 |
| Molecular Formula | C19H23N7O3 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]urea |
| SMILES | COc1cc(NC(=O)NCCNc2cc(-n3ccnc3C)ncn2)cc(OC)c1 |
| InChI | InChI=1S/C19H23N7O3/c1-13-20-6-7-26(13)18-11-17(23-12-24-18)21-4-5-22-19(27)25-14-8-15(28-2)10-16(9-14)29-3/h6-12H,4-5H2,1-3H3,(H,21,23,24)(H2,22,25,27) |
| InChIKey | YTMTWSZKQXFHSL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|