C15H15BrN6OS — CID 122290901
4-bromo-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]thiophene-2-carboxamide (PubChem CID 122290901) has the molecular formula C15H15BrN6OS and a molecular weight of 407.30 g/mol. Its IUPAC name is 4-bromo-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]thiophene-2-carboxamide.
| Compound Name | 4-bromo-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 122290901 |
| Molecular Formula | C15H15BrN6OS |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 4-bromo-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]thiophene-2-carboxamide |
| SMILES | Cc1nccn1-c1cc(NCCNC(=O)c2cc(Br)cs2)ncn1 |
| InChI | InChI=1S/C15H15BrN6OS/c1-10-17-4-5-22(10)14-7-13(20-9-21-14)18-2-3-19-15(23)12-6-11(16)8-24-12/h4-9H,2-3H2,1H3,(H,19,23)(H,18,20,21) |
| InChIKey | MPJKEPKVSFVESY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|