C18H21N7O2 — CID 122290944
6-ethoxy-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]pyridine-3-carboxamide (PubChem CID 122290944) has the molecular formula C18H21N7O2 and a molecular weight of 367.41 g/mol. Its IUPAC name is 6-ethoxy-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]pyridine-3-carboxamide.
| Compound Name | 6-ethoxy-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 122290944 |
| Molecular Formula | C18H21N7O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 6-ethoxy-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]pyridine-3-carboxamide |
| SMILES | CCOc1ccc(C(=O)NCCNc2cc(-n3ccnc3C)ncn2)cn1 |
| InChI | InChI=1S/C18H21N7O2/c1-3-27-17-5-4-14(11-22-17)18(26)21-7-6-20-15-10-16(24-12-23-15)25-9-8-19-13(25)2/h4-5,8-12H,3,6-7H2,1-2H3,(H,21,26)(H,20,23,24) |
| InChIKey | OMKFLAKEKZXVNW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|