C15H20N6O — CID 122290861
N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]cyclobutanecarboxamide (PubChem CID 122290861) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]cyclobutanecarboxamide.
| Compound Name | N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 122290861 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]cyclobutanecarboxamide |
| SMILES | Cc1nccn1-c1cc(NCCNC(=O)C2CCC2)ncn1 |
| InChI | InChI=1S/C15H20N6O/c1-11-16-7-8-21(11)14-9-13(19-10-20-14)17-5-6-18-15(22)12-3-2-4-12/h7-10,12H,2-6H2,1H3,(H,18,22)(H,17,19,20) |
| InChIKey | RTLDUNFAOGHAHX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|