C21H26N6O — CID 56919538
4-tert-butyl-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide (PubChem CID 56919538) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 56919538 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 4-tert-butyl-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide |
| SMILES | Cc1nccn1-c1cc(NCCNC(=O)c2ccc(C(C)(C)C)cc2)ncn1 |
| InChI | InChI=1S/C21H26N6O/c1-15-22-11-12-27(15)19-13-18(25-14-26-19)23-9-10-24-20(28)16-5-7-17(8-6-16)21(2,3)4/h5-8,11-14H,9-10H2,1-4H3,(H,24,28)(H,23,25,26) |
| InChIKey | SYPPMFOGULKSMQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|