C18H18F2N6O3S — CID 122290885
2-(difluoromethylsulfonyl)-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide (PubChem CID 122290885) has the molecular formula C18H18F2N6O3S and a molecular weight of 436.44 g/mol. Its IUPAC name is 2-(difluoromethylsulfonyl)-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide.
| Compound Name | 2-(difluoromethylsulfonyl)-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 122290885 |
| Molecular Formula | C18H18F2N6O3S |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 2-(difluoromethylsulfonyl)-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]benzamide |
| SMILES | Cc1nccn1-c1cc(NCCNC(=O)c2ccccc2S(=O)(=O)C(F)F)ncn1 |
| InChI | InChI=1S/C18H18F2N6O3S/c1-12-21-8-9-26(12)16-10-15(24-11-25-16)22-6-7-23-17(27)13-4-2-3-5-14(13)30(28,29)18(19)20/h2-5,8-11,18H,6-7H2,1H3,(H,23,27)(H,22,24,25) |
| InChIKey | SJZCJOOFCWTDJW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|