C18H19FN6O2 — CID 122290837
2-(2-fluorophenoxy)-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 122290837) has the molecular formula C18H19FN6O2 and a molecular weight of 370.39 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | 2-(2-fluorophenoxy)-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 122290837 |
| Molecular Formula | C18H19FN6O2 |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-[2-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | Cc1nccn1-c1cc(NCCNC(=O)COc2ccccc2F)ncn1 |
| InChI | InChI=1S/C18H19FN6O2/c1-13-20-8-9-25(13)17-10-16(23-12-24-17)21-6-7-22-18(26)11-27-15-5-3-2-4-14(15)19/h2-5,8-10,12H,6-7,11H2,1H3,(H,22,26)(H,21,23,24) |
| InChIKey | TVFMRWGEYHVDHU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|